About N-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethyl]-2-ethoxypropanamide
N-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethyl]-2-ethoxypropanamide (PubChem CID 58331274) has the molecular formula C14H21N3O5
and a molecular weight of 311.34 g/mol. Its IUPAC name is N-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethyl]-2-ethoxypropanamide.
Molecular Properties
| Compound Name | N-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethyl]-2-ethoxypropanamide |
| PubChem CID | 58331274 |
| Molecular Formula | C14H21N3O5 |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.15 |
| IUPAC Name | N-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethyl]-2-ethoxypropanamide |
| SMILES | CCOC(C)C(=O)NCCNC(=O)CCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C14H21N3O5/c1-3-22-10(2)14(21)16-8-7-15-11(18)6-9-17-12(19)4-5-13(17)20/h4-5,10H,3,6-9H2,1-2H3,(H,15,18)(H,16,21) |
| InChIKey | QNKOZRZTGHRSFM-UHFFFAOYSA-N |
| XLogP | -1.04 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze N-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethyl]-2-ethoxypropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethyl]-2-ethoxypropanamide?
The IUPAC name of N-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethyl]-2-ethoxypropanamide (CID 58331274) is N-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethyl]-2-ethoxypropanamide.
What is the SMILES notation for N-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethyl]-2-ethoxypropanamide?
The canonical SMILES for N-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethyl]-2-ethoxypropanamide is CCOC(C)C(=O)NCCNC(=O)CCN1C(=O)C=CC1=O.
What is the InChIKey of N-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethyl]-2-ethoxypropanamide?
The InChIKey is QNKOZRZTGHRSFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21N3O5/c1-3-22-10(2)14(21)16-8-7-15-11(18)6-9-17-12(19)4-5-13(17)20/h4-5,10H,3,6-9H2,1-2H3,(H,15,18)(H,16,21).
What are the key properties of N-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethyl]-2-ethoxypropanamide?
N-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethyl]-2-ethoxypropanamide has a molecular weight of 311.34 g/mol, XLogP of -1.04, 9 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethyl]-2-ethoxypropanamide is sourced from PubChem (CID 58331274), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).