C21H31N5O8 — CID 58331330
ethyl N-[1-[1-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethenylamino]-6-(ethoxycarbonylamino)-1-oxohexan-2-yl]carbamate (PubChem CID 58331330) has the molecular formula C21H31N5O8 and a molecular weight of 481.51 g/mol. Its IUPAC name is ethyl N-[1-[1-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethenylamino]-6-(ethoxycarbonylamino)-1-oxohexan-2-yl]carbamate.
| Compound Name | ethyl N-[1-[1-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethenylamino]-6-(ethoxycarbonylamino)-1-oxohexan-2-yl]carbamate |
|---|---|
| PubChem CID | 58331330 |
| Molecular Formula | C21H31N5O8 |
| Molecular Weight | 481.51 g/mol |
| Exact Mass | 481.22 |
| IUPAC Name | ethyl N-[1-[1-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethenylamino]-6-(ethoxycarbonylamino)-1-oxohexan-2-yl]carbamate |
| SMILES | C=C(NC(=O)CCN1C(=O)C=CC1=O)NC(=O)C(CCCCNC(=O)OCC)NC(=O)OCC |
| InChI | InChI=1S/C21H31N5O8/c1-4-33-20(31)22-12-7-6-8-15(25-21(32)34-5-2)19(30)24-14(3)23-16(27)11-13-26-17(28)9-10-18(26)29/h9-10,15H,3-8,11-13H2,1-2H3,(H,22,31)(H,23,27)(H,24,30)(H,25,32) |
| InChIKey | PVBHVACSJGBVRB-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 172.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.51 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|