C22H18N6O4 — CID 58331364
1-[(3-aminophenyl)methyl]-3-(2,6-dioxo-3,7-dihydropurin-1-yl)-5-methylindole-2-carboxylic acid (PubChem CID 58331364) has the molecular formula C22H18N6O4 and a molecular weight of 430.42 g/mol. Its IUPAC name is 1-[(3-aminophenyl)methyl]-3-(2,6-dioxo-3,7-dihydropurin-1-yl)-5-methylindole-2-carboxylic acid.
| Compound Name | 1-[(3-aminophenyl)methyl]-3-(2,6-dioxo-3,7-dihydropurin-1-yl)-5-methylindole-2-carboxylic acid |
|---|---|
| PubChem CID | 58331364 |
| Molecular Formula | C22H18N6O4 |
| Molecular Weight | 430.42 g/mol |
| Exact Mass | 430.14 |
| IUPAC Name | 1-[(3-aminophenyl)methyl]-3-(2,6-dioxo-3,7-dihydropurin-1-yl)-5-methylindole-2-carboxylic acid |
| SMILES | Cc1ccc2c(c1)c(-n1c(=O)[nH]c3nc[nH]c3c1=O)c(C(=O)O)n2Cc1cccc(N)c1 |
| InChI | InChI=1S/C22H18N6O4/c1-11-5-6-15-14(7-11)17(28-20(29)16-19(25-10-24-16)26-22(28)32)18(21(30)31)27(15)9-12-3-2-4-13(23)8-12/h2-8,10H,9,23H2,1H3,(H,24,25)(H,26,32)(H,30,31) |
| InChIKey | COVZPDLDYRXBNN-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 151.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.42 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|