About 5-chloro-3-(2,4-dioxo-1H-thieno[3,2-d]pyrimidin-3-yl)-1-methylindole-2-carboxylic acid
5-chloro-3-(2,4-dioxo-1H-thieno[3,2-d]pyrimidin-3-yl)-1-methylindole-2-carboxylic acid (PubChem CID 58331500) has the molecular formula C16H10ClN3O4S
and a molecular weight of 375.79 g/mol. Its IUPAC name is 5-chloro-3-(2,4-dioxo-1H-thieno[3,2-d]pyrimidin-3-yl)-1-methylindole-2-carboxylic acid.
Molecular Properties
| Compound Name | 5-chloro-3-(2,4-dioxo-1H-thieno[3,2-d]pyrimidin-3-yl)-1-methylindole-2-carboxylic acid |
| PubChem CID | 58331500 |
| Molecular Formula | C16H10ClN3O4S |
| Molecular Weight | 375.79 g/mol |
| Exact Mass | 375.01 |
| IUPAC Name | 5-chloro-3-(2,4-dioxo-1H-thieno[3,2-d]pyrimidin-3-yl)-1-methylindole-2-carboxylic acid |
| SMILES | Cn1c(C(=O)O)c(-n2c(=O)[nH]c3ccsc3c2=O)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C16H10ClN3O4S/c1-19-10-3-2-7(17)6-8(10)11(12(19)15(22)23)20-14(21)13-9(4-5-25-13)18-16(20)24/h2-6H,1H3,(H,18,24)(H,22,23) |
| InChIKey | RMUGZYHRNLOARU-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 97.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.79 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-chloro-3-(2,4-dioxo-1H-thieno[3,2-d]pyrimidin-3-yl)-1-methylindole-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-3-(2,4-dioxo-1H-thieno[3,2-d]pyrimidin-3-yl)-1-methylindole-2-carboxylic acid?
The IUPAC name of 5-chloro-3-(2,4-dioxo-1H-thieno[3,2-d]pyrimidin-3-yl)-1-methylindole-2-carboxylic acid (CID 58331500) is 5-chloro-3-(2,4-dioxo-1H-thieno[3,2-d]pyrimidin-3-yl)-1-methylindole-2-carboxylic acid.
What is the SMILES notation for 5-chloro-3-(2,4-dioxo-1H-thieno[3,2-d]pyrimidin-3-yl)-1-methylindole-2-carboxylic acid?
The canonical SMILES for 5-chloro-3-(2,4-dioxo-1H-thieno[3,2-d]pyrimidin-3-yl)-1-methylindole-2-carboxylic acid is Cn1c(C(=O)O)c(-n2c(=O)[nH]c3ccsc3c2=O)c2cc(Cl)ccc21.
What is the InChIKey of 5-chloro-3-(2,4-dioxo-1H-thieno[3,2-d]pyrimidin-3-yl)-1-methylindole-2-carboxylic acid?
The InChIKey is RMUGZYHRNLOARU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10ClN3O4S/c1-19-10-3-2-7(17)6-8(10)11(12(19)15(22)23)20-14(21)13-9(4-5-25-13)18-16(20)24/h2-6H,1H3,(H,18,24)(H,22,23).
What are the key properties of 5-chloro-3-(2,4-dioxo-1H-thieno[3,2-d]pyrimidin-3-yl)-1-methylindole-2-carboxylic acid?
5-chloro-3-(2,4-dioxo-1H-thieno[3,2-d]pyrimidin-3-yl)-1-methylindole-2-carboxylic acid has a molecular weight of 375.79 g/mol, XLogP of 2.58, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-3-(2,4-dioxo-1H-thieno[3,2-d]pyrimidin-3-yl)-1-methylindole-2-carboxylic acid is sourced from PubChem (CID 58331500), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).