C32H42ClN3O6S — CID 58331633
N-[(2S)-1-[(8S)-3-(3-chlorophenyl)-8-[(3R)-6-cyclopropyl-4,5-dioxo-3-propylhexanoyl]-1-oxa-2,7-diazaspiro[4.4]non-2-en-7-yl]-4-ethylsulfanyl-1-oxobutan-2-yl]acetamide (PubChem CID 58331633) has the molecular formula C32H42ClN3O6S and a molecular weight of 632.22 g/mol. Its IUPAC name is N-[(2S)-1-[(8S)-3-(3-chlorophenyl)-8-[(3R)-6-cyclopropyl-4,5-dioxo-3-propylhexanoyl]-1-oxa-2,7-diazaspiro[4.4]non-2-en-7-yl]-4-ethylsulfanyl-1-oxobutan-2-yl]acetamide.
| Compound Name | N-[(2S)-1-[(8S)-3-(3-chlorophenyl)-8-[(3R)-6-cyclopropyl-4,5-dioxo-3-propylhexanoyl]-1-oxa-2,7-diazaspiro[4.4]non-2-en-7-yl]-4-ethylsulfanyl-1-oxobutan-2-yl]acetamide |
|---|---|
| PubChem CID | 58331633 |
| Molecular Formula | C32H42ClN3O6S |
| Molecular Weight | 632.22 g/mol |
| Exact Mass | 631.25 |
| IUPAC Name | N-[(2S)-1-[(8S)-3-(3-chlorophenyl)-8-[(3R)-6-cyclopropyl-4,5-dioxo-3-propylhexanoyl]-1-oxa-2,7-diazaspiro[4.4]non-2-en-7-yl]-4-ethylsulfanyl-1-oxobutan-2-yl]acetamide |
| SMILES | CCC[C@H](CC(=O)[C@@H]1CC2(CC(c3cccc(Cl)c3)=NO2)CN1C(=O)[C@H](CCSCC)NC(C)=O)C(=O)C(=O)CC1CC1 |
| InChI | InChI=1S/C32H42ClN3O6S/c1-4-7-23(30(40)29(39)14-21-10-11-21)16-28(38)27-18-32(17-26(35-42-32)22-8-6-9-24(33)15-22)19-36(27)31(41)25(34-20(3)37)12-13-43-5-2/h6,8-9,15,21,23,25,27H,4-5,7,10-14,16-19H2,1-3H3,(H,34,37)/t23-,25+,27+,32?/m1/s1 |
| InChIKey | OMCJMQOWHCHQAP-XXSDMBPCSA-N |
| XLogP | 4.77 |
| TPSA | 122.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.22 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|