C6H3ClN2S — CID 58332178
7-chloro-[1,3]thiazolo[5,4-b]pyridine (PubChem CID 58332178) has the molecular formula C6H3ClN2S and a molecular weight of 170.62 g/mol. Its IUPAC name is 7-chloro-[1,3]thiazolo[5,4-b]pyridine.
| Compound Name | 7-chloro-[1,3]thiazolo[5,4-b]pyridine |
|---|---|
| PubChem CID | 58332178 |
| Molecular Formula | C6H3ClN2S |
| Molecular Weight | 170.62 g/mol |
| Exact Mass | 169.97 |
| IUPAC Name | 7-chloro-[1,3]thiazolo[5,4-b]pyridine |
| SMILES | Clc1ccnc2scnc12 |
| InChI | InChI=1S/C6H3ClN2S/c7-4-1-2-8-6-5(4)9-3-10-6/h1-3H |
| InChIKey | HLANSJRABYKWOZ-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.62 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |