About 7-bromo-1,1,2-trimethyl-3-pentylbenzo[e]indol-3-ium
7-bromo-1,1,2-trimethyl-3-pentylbenzo[e]indol-3-ium (PubChem CID 58332550) has the molecular formula C20H25BrN+
and a molecular weight of 359.33 g/mol. Its IUPAC name is 7-bromo-1,1,2-trimethyl-3-pentylbenzo[e]indol-3-ium.
Molecular Properties
| Compound Name | 7-bromo-1,1,2-trimethyl-3-pentylbenzo[e]indol-3-ium |
| PubChem CID | 58332550 |
| Molecular Formula | C20H25BrN+ |
| Molecular Weight | 359.33 g/mol |
| Exact Mass | 358.12 |
| IUPAC Name | 7-bromo-1,1,2-trimethyl-3-pentylbenzo[e]indol-3-ium |
| SMILES | CCCCC[N+]1=C(C)C(C)(C)c2c1ccc1cc(Br)ccc21 |
| InChI | InChI=1S/C20H25BrN/c1-5-6-7-12-22-14(2)20(3,4)19-17-10-9-16(21)13-15(17)8-11-18(19)22/h8-11,13H,5-7,12H2,1-4H3/q+1 |
| InChIKey | VNJFRYLASNCAQS-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 359.33 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 7-bromo-1,1,2-trimethyl-3-pentylbenzo[e]indol-3-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bromo-1,1,2-trimethyl-3-pentylbenzo[e]indol-3-ium?
The IUPAC name of 7-bromo-1,1,2-trimethyl-3-pentylbenzo[e]indol-3-ium (CID 58332550) is 7-bromo-1,1,2-trimethyl-3-pentylbenzo[e]indol-3-ium.
What is the SMILES notation for 7-bromo-1,1,2-trimethyl-3-pentylbenzo[e]indol-3-ium?
The canonical SMILES for 7-bromo-1,1,2-trimethyl-3-pentylbenzo[e]indol-3-ium is CCCCC[N+]1=C(C)C(C)(C)c2c1ccc1cc(Br)ccc21.
What is the InChIKey of 7-bromo-1,1,2-trimethyl-3-pentylbenzo[e]indol-3-ium?
The InChIKey is VNJFRYLASNCAQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H25BrN/c1-5-6-7-12-22-14(2)20(3,4)19-17-10-9-16(21)13-15(17)8-11-18(19)22/h8-11,13H,5-7,12H2,1-4H3/q+1.
What are the key properties of 7-bromo-1,1,2-trimethyl-3-pentylbenzo[e]indol-3-ium?
7-bromo-1,1,2-trimethyl-3-pentylbenzo[e]indol-3-ium has a molecular weight of 359.33 g/mol, XLogP of 6.19, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromo-1,1,2-trimethyl-3-pentylbenzo[e]indol-3-ium is sourced from PubChem (CID 58332550), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).