C26H35Cl3N4O7 — CID 58332990
[(3R,4R)-5-azido-4-methyl-6-(2,2,2-trichloroethanimidoyl)oxy-3-[(2S,4R,5S)-3,5,6-trimethyl-4-phenylmethoxyoxan-2-yl]oxyoxan-2-yl]methyl acetate (PubChem CID 58332990) has the molecular formula C26H35Cl3N4O7 and a molecular weight of 621.95 g/mol. Its IUPAC name is [(3R,4R)-5-azido-4-methyl-6-(2,2,2-trichloroethanimidoyl)oxy-3-[(2S,4R,5S)-3,5,6-trimethyl-4-phenylmethoxyoxan-2-yl]oxyoxan-2-yl]methyl acetate.
| Compound Name | [(3R,4R)-5-azido-4-methyl-6-(2,2,2-trichloroethanimidoyl)oxy-3-[(2S,4R,5S)-3,5,6-trimethyl-4-phenylmethoxyoxan-2-yl]oxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 58332990 |
| Molecular Formula | C26H35Cl3N4O7 |
| Molecular Weight | 621.95 g/mol |
| Exact Mass | 620.16 |
| IUPAC Name | [(3R,4R)-5-azido-4-methyl-6-(2,2,2-trichloroethanimidoyl)oxy-3-[(2S,4R,5S)-3,5,6-trimethyl-4-phenylmethoxyoxan-2-yl]oxyoxan-2-yl]methyl acetate |
| SMILES | [H]/N=C(/OC1OC(COC(C)=O)[C@H](O[C@@H]2OC(C)[C@H](C)[C@@H](OCc3ccccc3)C2C)[C@H](C)C1N=[N+]=[N-])C(Cl)(Cl)Cl |
| InChI | InChI=1S/C26H35Cl3N4O7/c1-13-16(4)37-23(15(3)21(13)36-11-18-9-7-6-8-10-18)39-22-14(2)20(32-33-31)24(40-25(30)26(27,28)29)38-19(22)12-35-17(5)34/h6-10,13-16,19-24,30H,11-12H2,1-5H3/b30-25+/t13-,14+,15?,16?,19?,20?,21+,22+,23-,24?/m0/s1 |
| InChIKey | XEKSLIBHTGECNM-SWQLTPCOSA-N |
| XLogP | 5.94 |
| TPSA | 145.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.95 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|