About (2S)-1-methyl-2-[(Z,3R)-3-methylhept-5-en-2-yl]piperidin-3-one
(2S)-1-methyl-2-[(Z,3R)-3-methylhept-5-en-2-yl]piperidin-3-one (PubChem CID 58333060) has the molecular formula C14H25NO
and a molecular weight of 223.36 g/mol. Its IUPAC name is (2S)-1-methyl-2-[(Z,3R)-3-methylhept-5-en-2-yl]piperidin-3-one.
Molecular Properties
| Compound Name | (2S)-1-methyl-2-[(Z,3R)-3-methylhept-5-en-2-yl]piperidin-3-one |
| PubChem CID | 58333060 |
| Molecular Formula | C14H25NO |
| Molecular Weight | 223.36 g/mol |
| Exact Mass | 223.19 |
| IUPAC Name | (2S)-1-methyl-2-[(Z,3R)-3-methylhept-5-en-2-yl]piperidin-3-one |
| SMILES | C/C=C\C[C@@H](C)C(C)C1C(=O)CCCN1C |
| InChI | InChI=1S/C14H25NO/c1-5-6-8-11(2)12(3)14-13(16)9-7-10-15(14)4/h5-6,11-12,14H,7-10H2,1-4H3/b6-5-/t11-,12?,14?/m1/s1 |
| InChIKey | QRQIQIYKXLEWMQ-CHOFREOFSA-N |
| XLogP | 2.89 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.36 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2S)-1-methyl-2-[(Z,3R)-3-methylhept-5-en-2-yl]piperidin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-1-methyl-2-[(Z,3R)-3-methylhept-5-en-2-yl]piperidin-3-one?
The IUPAC name of (2S)-1-methyl-2-[(Z,3R)-3-methylhept-5-en-2-yl]piperidin-3-one (CID 58333060) is (2S)-1-methyl-2-[(Z,3R)-3-methylhept-5-en-2-yl]piperidin-3-one.
What is the SMILES notation for (2S)-1-methyl-2-[(Z,3R)-3-methylhept-5-en-2-yl]piperidin-3-one?
The canonical SMILES for (2S)-1-methyl-2-[(Z,3R)-3-methylhept-5-en-2-yl]piperidin-3-one is C/C=C\C[C@@H](C)C(C)C1C(=O)CCCN1C.
What is the InChIKey of (2S)-1-methyl-2-[(Z,3R)-3-methylhept-5-en-2-yl]piperidin-3-one?
The InChIKey is QRQIQIYKXLEWMQ-CHOFREOFSA-N. The full InChI is InChI=1S/C14H25NO/c1-5-6-8-11(2)12(3)14-13(16)9-7-10-15(14)4/h5-6,11-12,14H,7-10H2,1-4H3/b6-5-/t11-,12?,14?/m1/s1.
What are the key properties of (2S)-1-methyl-2-[(Z,3R)-3-methylhept-5-en-2-yl]piperidin-3-one?
(2S)-1-methyl-2-[(Z,3R)-3-methylhept-5-en-2-yl]piperidin-3-one has a molecular weight of 223.36 g/mol, XLogP of 2.89, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-1-methyl-2-[(Z,3R)-3-methylhept-5-en-2-yl]piperidin-3-one is sourced from PubChem (CID 58333060), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).