C8H9N3O2S — CID 58333752
2-propyl-4H-[1,3]thiazolo[5,4-d]pyrimidine-5,7-dione (PubChem CID 58333752) has the molecular formula C8H9N3O2S and a molecular weight of 211.25 g/mol. Its IUPAC name is 2-propyl-4H-[1,3]thiazolo[5,4-d]pyrimidine-5,7-dione.
| Compound Name | 2-propyl-4H-[1,3]thiazolo[5,4-d]pyrimidine-5,7-dione |
|---|---|
| PubChem CID | 58333752 |
| Molecular Formula | C8H9N3O2S |
| Molecular Weight | 211.25 g/mol |
| Exact Mass | 211.04 |
| IUPAC Name | 2-propyl-4H-[1,3]thiazolo[5,4-d]pyrimidine-5,7-dione |
| SMILES | CCCc1nc2c(=O)[nH]c(=O)[nH]c2s1 |
| InChI | InChI=1S/C8H9N3O2S/c1-2-3-4-9-5-6(12)10-8(13)11-7(5)14-4/h2-3H2,1H3,(H2,10,11,12,13) |
| InChIKey | BRLNJGLQVQVGSZ-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 78.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.25 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |