About 5,7-dichloro-2-ethyl-[1,3]thiazolo[5,4-d]pyrimidine
5,7-dichloro-2-ethyl-[1,3]thiazolo[5,4-d]pyrimidine (PubChem CID 58333778) has the molecular formula C7H5Cl2N3S
and a molecular weight of 234.11 g/mol. Its IUPAC name is 5,7-dichloro-2-ethyl-[1,3]thiazolo[5,4-d]pyrimidine.
Molecular Properties
| Compound Name | 5,7-dichloro-2-ethyl-[1,3]thiazolo[5,4-d]pyrimidine |
| PubChem CID | 58333778 |
| Molecular Formula | C7H5Cl2N3S |
| Molecular Weight | 234.11 g/mol |
| Exact Mass | 232.96 |
| IUPAC Name | 5,7-dichloro-2-ethyl-[1,3]thiazolo[5,4-d]pyrimidine |
| SMILES | CCc1nc2c(Cl)nc(Cl)nc2s1 |
| InChI | InChI=1S/C7H5Cl2N3S/c1-2-3-10-4-5(8)11-7(9)12-6(4)13-3/h2H2,1H3 |
| InChIKey | ONUFDIKLDBRWRF-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.11 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5,7-dichloro-2-ethyl-[1,3]thiazolo[5,4-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,7-dichloro-2-ethyl-[1,3]thiazolo[5,4-d]pyrimidine?
The IUPAC name of 5,7-dichloro-2-ethyl-[1,3]thiazolo[5,4-d]pyrimidine (CID 58333778) is 5,7-dichloro-2-ethyl-[1,3]thiazolo[5,4-d]pyrimidine.
What is the SMILES notation for 5,7-dichloro-2-ethyl-[1,3]thiazolo[5,4-d]pyrimidine?
The canonical SMILES for 5,7-dichloro-2-ethyl-[1,3]thiazolo[5,4-d]pyrimidine is CCc1nc2c(Cl)nc(Cl)nc2s1.
What is the InChIKey of 5,7-dichloro-2-ethyl-[1,3]thiazolo[5,4-d]pyrimidine?
The InChIKey is ONUFDIKLDBRWRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5Cl2N3S/c1-2-3-10-4-5(8)11-7(9)12-6(4)13-3/h2H2,1H3.
What are the key properties of 5,7-dichloro-2-ethyl-[1,3]thiazolo[5,4-d]pyrimidine?
5,7-dichloro-2-ethyl-[1,3]thiazolo[5,4-d]pyrimidine has a molecular weight of 234.11 g/mol, XLogP of 2.96, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5,7-dichloro-2-ethyl-[1,3]thiazolo[5,4-d]pyrimidine is sourced from PubChem (CID 58333778), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).