About 6-methyl-3,4-dihydro-2H-pyrido[3,4-b]pyrazine
6-methyl-3,4-dihydro-2H-pyrido[3,4-b]pyrazine (PubChem CID 58333857) has the molecular formula C8H11N3
and a molecular weight of 149.20 g/mol. Its IUPAC name is 6-methyl-3,4-dihydro-2H-pyrido[3,4-b]pyrazine.
Molecular Properties
| Compound Name | 6-methyl-3,4-dihydro-2H-pyrido[3,4-b]pyrazine |
| PubChem CID | 58333857 |
| Molecular Formula | C8H11N3 |
| Molecular Weight | 149.20 g/mol |
| Exact Mass | 149.10 |
| IUPAC Name | 6-methyl-3,4-dihydro-2H-pyrido[3,4-b]pyrazine |
| SMILES | CN1C=CC2=NCCNC2=C1 |
| InChI | InChI=1S/C8H11N3/c1-11-5-2-7-8(6-11)10-4-3-9-7/h2,5-6,10H,3-4H2,1H3 |
| InChIKey | XKKISBDYWFXNCM-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.20 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-methyl-3,4-dihydro-2H-pyrido[3,4-b]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-3,4-dihydro-2H-pyrido[3,4-b]pyrazine?
The IUPAC name of 6-methyl-3,4-dihydro-2H-pyrido[3,4-b]pyrazine (CID 58333857) is 6-methyl-3,4-dihydro-2H-pyrido[3,4-b]pyrazine.
What is the SMILES notation for 6-methyl-3,4-dihydro-2H-pyrido[3,4-b]pyrazine?
The canonical SMILES for 6-methyl-3,4-dihydro-2H-pyrido[3,4-b]pyrazine is CN1C=CC2=NCCNC2=C1.
What is the InChIKey of 6-methyl-3,4-dihydro-2H-pyrido[3,4-b]pyrazine?
The InChIKey is XKKISBDYWFXNCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N3/c1-11-5-2-7-8(6-11)10-4-3-9-7/h2,5-6,10H,3-4H2,1H3.
What are the key properties of 6-methyl-3,4-dihydro-2H-pyrido[3,4-b]pyrazine?
6-methyl-3,4-dihydro-2H-pyrido[3,4-b]pyrazine has a molecular weight of 149.20 g/mol, XLogP of 0.33, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-3,4-dihydro-2H-pyrido[3,4-b]pyrazine is sourced from PubChem (CID 58333857), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).