C26H27F3N8OS — CID 58333922
(Z)-N-phenylmethoxy-1-[6-propyl-4-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]thieno[2,3-d]pyrimidin-2-yl]pyrrolidin-3-imine (PubChem CID 58333922) has the molecular formula C26H27F3N8OS and a molecular weight of 556.62 g/mol. Its IUPAC name is (Z)-N-phenylmethoxy-1-[6-propyl-4-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]thieno[2,3-d]pyrimidin-2-yl]pyrrolidin-3-imine.
| Compound Name | (Z)-N-phenylmethoxy-1-[6-propyl-4-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]thieno[2,3-d]pyrimidin-2-yl]pyrrolidin-3-imine |
|---|---|
| PubChem CID | 58333922 |
| Molecular Formula | C26H27F3N8OS |
| Molecular Weight | 556.62 g/mol |
| Exact Mass | 556.20 |
| IUPAC Name | (Z)-N-phenylmethoxy-1-[6-propyl-4-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]thieno[2,3-d]pyrimidin-2-yl]pyrrolidin-3-imine |
| SMILES | CCCc1cc2c(N3CCn4c(nnc4C(F)(F)F)C3)nc(N3CC/C(=N/OCc4ccccc4)C3)nc2s1 |
| InChI | InChI=1S/C26H27F3N8OS/c1-2-6-19-13-20-22(35-11-12-37-21(15-35)32-33-24(37)26(27,28)29)30-25(31-23(20)39-19)36-10-9-18(14-36)34-38-16-17-7-4-3-5-8-17/h3-5,7-8,13H,2,6,9-12,14-16H2,1H3/b34-18- |
| InChIKey | LFOYUPARMCIGJT-HQDYHJHZSA-N |
| XLogP | 5.06 |
| TPSA | 84.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.62 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|