C19H23F3N8S — CID 58334019
6-propyl-N-[(3S)-pyrrolidin-3-yl]-4-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]thieno[2,3-d]pyrimidin-2-amine (PubChem CID 58334019) has the molecular formula C19H23F3N8S and a molecular weight of 452.51 g/mol. Its IUPAC name is 6-propyl-N-[(3S)-pyrrolidin-3-yl]-4-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]thieno[2,3-d]pyrimidin-2-amine.
| Compound Name | 6-propyl-N-[(3S)-pyrrolidin-3-yl]-4-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]thieno[2,3-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 58334019 |
| Molecular Formula | C19H23F3N8S |
| Molecular Weight | 452.51 g/mol |
| Exact Mass | 452.17 |
| IUPAC Name | 6-propyl-N-[(3S)-pyrrolidin-3-yl]-4-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]thieno[2,3-d]pyrimidin-2-amine |
| SMILES | CCCc1cc2c(N3CCn4c(nnc4C(F)(F)F)C3)nc(N[C@H]3CCNC3)nc2s1 |
| InChI | InChI=1S/C19H23F3N8S/c1-2-3-12-8-13-15(25-18(26-16(13)31-12)24-11-4-5-23-9-11)29-6-7-30-14(10-29)27-28-17(30)19(20,21)22/h8,11,23H,2-7,9-10H2,1H3,(H,24,25,26)/t11-/m0/s1 |
| InChIKey | KWKSQOVXCBJDEQ-NSHDSACASA-N |
| XLogP | 3.05 |
| TPSA | 83.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.51 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |