C21H18F3NO2 — CID 583341
10-cyclopentylidene-4-[3-(trifluoromethyl)phenyl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (PubChem CID 583341) has the molecular formula C21H18F3NO2 and a molecular weight of 373.37 g/mol. Its IUPAC name is 10-cyclopentylidene-4-[3-(trifluoromethyl)phenyl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione.
| Compound Name | 10-cyclopentylidene-4-[3-(trifluoromethyl)phenyl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 583341 |
| Molecular Formula | C21H18F3NO2 |
| Molecular Weight | 373.37 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | 10-cyclopentylidene-4-[3-(trifluoromethyl)phenyl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| SMILES | O=C1C2C3C=CC(C3=C3CCCC3)C2C(=O)N1c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H18F3NO2/c22-21(23,24)12-6-3-7-13(10-12)25-19(26)17-14-8-9-15(18(17)20(25)27)16(14)11-4-1-2-5-11/h3,6-10,14-15,17-18H,1-2,4-5H2 |
| InChIKey | RDDOMPLINKUVSR-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.37 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|