C7H7N3O2S — CID 58334128
2-ethyl-4H-[1,3]thiazolo[5,4-d]pyrimidine-5,7-dione (PubChem CID 58334128) has the molecular formula C7H7N3O2S and a molecular weight of 197.22 g/mol. Its IUPAC name is 2-ethyl-4H-[1,3]thiazolo[5,4-d]pyrimidine-5,7-dione.
| Compound Name | 2-ethyl-4H-[1,3]thiazolo[5,4-d]pyrimidine-5,7-dione |
|---|---|
| PubChem CID | 58334128 |
| Molecular Formula | C7H7N3O2S |
| Molecular Weight | 197.22 g/mol |
| Exact Mass | 197.03 |
| IUPAC Name | 2-ethyl-4H-[1,3]thiazolo[5,4-d]pyrimidine-5,7-dione |
| SMILES | CCc1nc2c(=O)[nH]c(=O)[nH]c2s1 |
| InChI | InChI=1S/C7H7N3O2S/c1-2-3-8-4-5(11)9-7(12)10-6(4)13-3/h2H2,1H3,(H2,9,10,11,12) |
| InChIKey | OUPDVSZQYIGWHT-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 78.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.22 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |