About 1-(2-methoxyethyl)-2,4-dimethylimidazole
1-(2-methoxyethyl)-2,4-dimethylimidazole (PubChem CID 58335334) has the molecular formula C8H14N2O
and a molecular weight of 154.21 g/mol. Its IUPAC name is 1-(2-methoxyethyl)-2,4-dimethylimidazole.
Molecular Properties
| Compound Name | 1-(2-methoxyethyl)-2,4-dimethylimidazole |
| PubChem CID | 58335334 |
| Molecular Formula | C8H14N2O |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.11 |
| IUPAC Name | 1-(2-methoxyethyl)-2,4-dimethylimidazole |
| SMILES | COCCn1cc(C)nc1C |
| InChI | InChI=1S/C8H14N2O/c1-7-6-10(4-5-11-3)8(2)9-7/h6H,4-5H2,1-3H3 |
| InChIKey | JKPZVPOJXJPFPG-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(2-methoxyethyl)-2,4-dimethylimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-methoxyethyl)-2,4-dimethylimidazole?
The IUPAC name of 1-(2-methoxyethyl)-2,4-dimethylimidazole (CID 58335334) is 1-(2-methoxyethyl)-2,4-dimethylimidazole.
What is the SMILES notation for 1-(2-methoxyethyl)-2,4-dimethylimidazole?
The canonical SMILES for 1-(2-methoxyethyl)-2,4-dimethylimidazole is COCCn1cc(C)nc1C.
What is the InChIKey of 1-(2-methoxyethyl)-2,4-dimethylimidazole?
The InChIKey is JKPZVPOJXJPFPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2O/c1-7-6-10(4-5-11-3)8(2)9-7/h6H,4-5H2,1-3H3.
What are the key properties of 1-(2-methoxyethyl)-2,4-dimethylimidazole?
1-(2-methoxyethyl)-2,4-dimethylimidazole has a molecular weight of 154.21 g/mol, XLogP of 1.15, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-methoxyethyl)-2,4-dimethylimidazole is sourced from PubChem (CID 58335334), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).