C21H23F3N6O3 — CID 58336579
N,2-dimethoxy-6-[[5-(trifluoromethyl)-2-[(1,3,5-trimethylpyrazol-4-yl)amino]-4-pyridinyl]amino]benzamide (PubChem CID 58336579) has the molecular formula C21H23F3N6O3 and a molecular weight of 464.45 g/mol. Its IUPAC name is N,2-dimethoxy-6-[[5-(trifluoromethyl)-2-[(1,3,5-trimethylpyrazol-4-yl)amino]-4-pyridinyl]amino]benzamide.
| Compound Name | N,2-dimethoxy-6-[[5-(trifluoromethyl)-2-[(1,3,5-trimethylpyrazol-4-yl)amino]-4-pyridinyl]amino]benzamide |
|---|---|
| PubChem CID | 58336579 |
| Molecular Formula | C21H23F3N6O3 |
| Molecular Weight | 464.45 g/mol |
| Exact Mass | 464.18 |
| IUPAC Name | N,2-dimethoxy-6-[[5-(trifluoromethyl)-2-[(1,3,5-trimethylpyrazol-4-yl)amino]-4-pyridinyl]amino]benzamide |
| SMILES | CONC(=O)c1c(Nc2cc(Nc3c(C)nn(C)c3C)ncc2C(F)(F)F)cccc1OC |
| InChI | InChI=1S/C21H23F3N6O3/c1-11-19(12(2)30(3)28-11)27-17-9-15(13(10-25-17)21(22,23)24)26-14-7-6-8-16(32-4)18(14)20(31)29-33-5/h6-10H,1-5H3,(H,29,31)(H2,25,26,27) |
| InChIKey | AQXDJRPJVMFLQF-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 102.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.45 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|