About 1-methoxy-1-methoxy-N,N-dimethylmethanamine
1-methoxy-1-methoxy-N,N-dimethylmethanamine (PubChem CID 58336844) has the molecular formula C5H12NO2+
and a molecular weight of 118.16 g/mol. Its IUPAC name is 1-methoxy-1-methoxy-N,N-dimethylmethanamine.
Molecular Properties
| Compound Name | 1-methoxy-1-methoxy-N,N-dimethylmethanamine |
| PubChem CID | 58336844 |
| Molecular Formula | C5H12NO2+ |
| Molecular Weight | 118.16 g/mol |
| Exact Mass | 118.09 |
| IUPAC Name | 1-methoxy-1-methoxy-N,N-dimethylmethanamine |
| SMILES | [CH2+]OC(OC)N(C)C |
| InChI | InChI=1S/C5H12NO2/c1-6(2)5(7-3)8-4/h5H,3H2,1-2,4H3/q+1 |
| InChIKey | AYDCJRZEHZCDAW-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 118.16 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-methoxy-1-methoxy-N,N-dimethylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methoxy-1-methoxy-N,N-dimethylmethanamine?
The IUPAC name of 1-methoxy-1-methoxy-N,N-dimethylmethanamine (CID 58336844) is 1-methoxy-1-methoxy-N,N-dimethylmethanamine.
What is the SMILES notation for 1-methoxy-1-methoxy-N,N-dimethylmethanamine?
The canonical SMILES for 1-methoxy-1-methoxy-N,N-dimethylmethanamine is [CH2+]OC(OC)N(C)C.
What is the InChIKey of 1-methoxy-1-methoxy-N,N-dimethylmethanamine?
The InChIKey is AYDCJRZEHZCDAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12NO2/c1-6(2)5(7-3)8-4/h5H,3H2,1-2,4H3/q+1.
What are the key properties of 1-methoxy-1-methoxy-N,N-dimethylmethanamine?
1-methoxy-1-methoxy-N,N-dimethylmethanamine has a molecular weight of 118.16 g/mol, XLogP of 0.29, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxy-1-methoxy-N,N-dimethylmethanamine is sourced from PubChem (CID 58336844), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).