C27H28ClFN2O6S — CID 58337202
[4-[5-[(5-fluoro-2-methylphenoxy)methyl]-2,2,4-trimethyl-3-oxo-1H-quinoxalin-6-yl]-3-methoxyphenyl] chloromethanesulfonate (PubChem CID 58337202) has the molecular formula C27H28ClFN2O6S and a molecular weight of 563.05 g/mol. Its IUPAC name is [4-[5-[(5-fluoro-2-methylphenoxy)methyl]-2,2,4-trimethyl-3-oxo-1H-quinoxalin-6-yl]-3-methoxyphenyl] chloromethanesulfonate.
| Compound Name | [4-[5-[(5-fluoro-2-methylphenoxy)methyl]-2,2,4-trimethyl-3-oxo-1H-quinoxalin-6-yl]-3-methoxyphenyl] chloromethanesulfonate |
|---|---|
| PubChem CID | 58337202 |
| Molecular Formula | C27H28ClFN2O6S |
| Molecular Weight | 563.05 g/mol |
| Exact Mass | 562.13 |
| IUPAC Name | [4-[5-[(5-fluoro-2-methylphenoxy)methyl]-2,2,4-trimethyl-3-oxo-1H-quinoxalin-6-yl]-3-methoxyphenyl] chloromethanesulfonate |
| SMILES | COc1cc(OS(=O)(=O)CCl)ccc1-c1ccc2c(c1COc1cc(F)ccc1C)N(C)C(=O)C(C)(C)N2 |
| InChI | InChI=1S/C27H28ClFN2O6S/c1-16-6-7-17(29)12-23(16)36-14-21-19(10-11-22-25(21)31(4)26(32)27(2,3)30-22)20-9-8-18(13-24(20)35-5)37-38(33,34)15-28/h6-13,30H,14-15H2,1-5H3 |
| InChIKey | OTQQOACALAJYTC-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.05 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|