C20H13ClN2O2 — CID 58337442
N-[3-[(5-chloro-3-pyridinyl)oxy]phenyl]-3-ethynylbenzamide (PubChem CID 58337442) has the molecular formula C20H13ClN2O2 and a molecular weight of 348.79 g/mol. Its IUPAC name is N-[3-[(5-chloro-3-pyridinyl)oxy]phenyl]-3-ethynylbenzamide.
| Compound Name | N-[3-[(5-chloro-3-pyridinyl)oxy]phenyl]-3-ethynylbenzamide |
|---|---|
| PubChem CID | 58337442 |
| Molecular Formula | C20H13ClN2O2 |
| Molecular Weight | 348.79 g/mol |
| Exact Mass | 348.07 |
| IUPAC Name | N-[3-[(5-chloro-3-pyridinyl)oxy]phenyl]-3-ethynylbenzamide |
| SMILES | C#Cc1cccc(C(=O)Nc2cccc(Oc3cncc(Cl)c3)c2)c1 |
| InChI | InChI=1S/C20H13ClN2O2/c1-2-14-5-3-6-15(9-14)20(24)23-17-7-4-8-18(11-17)25-19-10-16(21)12-22-13-19/h1,3-13H,(H,23,24) |
| InChIKey | ACJXHGWRNUQEIN-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.79 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|