C20H16F3N5O2S — CID 58338018
N-[2-[2-methyl-4-[[4-(trifluoromethyl)-2-pyridinyl]oxy]phenoxy]ethyl]-[1,3]thiazolo[5,4-d]pyrimidin-7-amine (PubChem CID 58338018) has the molecular formula C20H16F3N5O2S and a molecular weight of 447.44 g/mol. Its IUPAC name is N-[2-[2-methyl-4-[[4-(trifluoromethyl)-2-pyridinyl]oxy]phenoxy]ethyl]-[1,3]thiazolo[5,4-d]pyrimidin-7-amine.
| Compound Name | N-[2-[2-methyl-4-[[4-(trifluoromethyl)-2-pyridinyl]oxy]phenoxy]ethyl]-[1,3]thiazolo[5,4-d]pyrimidin-7-amine |
|---|---|
| PubChem CID | 58338018 |
| Molecular Formula | C20H16F3N5O2S |
| Molecular Weight | 447.44 g/mol |
| Exact Mass | 447.10 |
| IUPAC Name | N-[2-[2-methyl-4-[[4-(trifluoromethyl)-2-pyridinyl]oxy]phenoxy]ethyl]-[1,3]thiazolo[5,4-d]pyrimidin-7-amine |
| SMILES | Cc1cc(Oc2cc(C(F)(F)F)ccn2)ccc1OCCNc1ncnc2scnc12 |
| InChI | InChI=1S/C20H16F3N5O2S/c1-12-8-14(30-16-9-13(4-5-24-16)20(21,22)23)2-3-15(12)29-7-6-25-18-17-19(27-10-26-18)31-11-28-17/h2-5,8-11H,6-7H2,1H3,(H,25,26,27) |
| InChIKey | LOYGIDCPDUFAEL-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 82.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.44 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|