About CID 58338156
CID 58338156 (PubChem CID 58338156) has the molecular formula C7H5BClN3
and a molecular weight of 177.40 g/mol.
Molecular Properties
| Compound Name | CID 58338156 |
| PubChem CID | 58338156 |
| Molecular Formula | C7H5BClN3 |
| Molecular Weight | 177.40 g/mol |
| Exact Mass | 177.03 |
| IUPAC Name | — |
| SMILES | [B]Cn1ccc2c(Cl)ncnc21 |
| InChI | InChI=1S/C7H5BClN3/c8-3-12-2-1-5-6(9)10-4-11-7(5)12/h1-2,4H,3H2 |
| InChIKey | ZKOSRXZQMQJQIL-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.40 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 58338156 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 58338156?
The IUPAC name of CID 58338156 (CID 58338156) is not available.
What is the SMILES notation for CID 58338156?
The canonical SMILES for CID 58338156 is [B]Cn1ccc2c(Cl)ncnc21.
What is the InChIKey of CID 58338156?
The InChIKey is ZKOSRXZQMQJQIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5BClN3/c8-3-12-2-1-5-6(9)10-4-11-7(5)12/h1-2,4H,3H2.
What are the key properties of CID 58338156?
CID 58338156 has a molecular weight of 177.40 g/mol, XLogP of 1.21, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 58338156 is sourced from PubChem (CID 58338156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).