C23H28ClN2O3+ — CID 58338650
1-(9-chloro-4-methyl-13-oxa-4-azoniatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),7(12),8,10,14,16-hexaen-4-yl)ethyl N-ethyl-N-methylcarbamate (PubChem CID 58338650) has the molecular formula C23H28ClN2O3+ and a molecular weight of 415.94 g/mol. Its IUPAC name is 1-(9-chloro-4-methyl-13-oxa-4-azoniatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),7(12),8,10,14,16-hexaen-4-yl)ethyl N-ethyl-N-methylcarbamate.
| Compound Name | 1-(9-chloro-4-methyl-13-oxa-4-azoniatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),7(12),8,10,14,16-hexaen-4-yl)ethyl N-ethyl-N-methylcarbamate |
|---|---|
| PubChem CID | 58338650 |
| Molecular Formula | C23H28ClN2O3+ |
| Molecular Weight | 415.94 g/mol |
| Exact Mass | 415.18 |
| IUPAC Name | 1-(9-chloro-4-methyl-13-oxa-4-azoniatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),7(12),8,10,14,16-hexaen-4-yl)ethyl N-ethyl-N-methylcarbamate |
| SMILES | CCN(C)C(=O)OC(C)[N+]1(C)CC2c3ccccc3Oc3ccc(Cl)cc3C2C1 |
| InChI | InChI=1S/C23H28ClN2O3/c1-5-25(3)23(27)28-15(2)26(4)13-19-17-8-6-7-9-21(17)29-22-11-10-16(24)12-18(22)20(19)14-26/h6-12,15,19-20H,5,13-14H2,1-4H3/q+1 |
| InChIKey | YDCPDNIEAQBQNJ-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.94 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|