About 1-O-(2-hydroxyethyl) 5-O-[3-[hydroxymethyl(dimethoxy)silyl]propyl] 2-ethyl-2,4,4-trimethylpentanedioate
1-O-(2-hydroxyethyl) 5-O-[3-[hydroxymethyl(dimethoxy)silyl]propyl] 2-ethyl-2,4,4-trimethylpentanedioate (PubChem CID 58338810) has the molecular formula C18H36O8Si
and a molecular weight of 408.56 g/mol. Its IUPAC name is 1-O-(2-hydroxyethyl) 5-O-[3-[hydroxymethyl(dimethoxy)silyl]propyl] 2-ethyl-2,4,4-trimethylpentanedioate.
Molecular Properties
| Compound Name | 1-O-(2-hydroxyethyl) 5-O-[3-[hydroxymethyl(dimethoxy)silyl]propyl] 2-ethyl-2,4,4-trimethylpentanedioate |
| PubChem CID | 58338810 |
| Molecular Formula | C18H36O8Si |
| Molecular Weight | 408.56 g/mol |
| Exact Mass | 408.22 |
| IUPAC Name | 1-O-(2-hydroxyethyl) 5-O-[3-[hydroxymethyl(dimethoxy)silyl]propyl] 2-ethyl-2,4,4-trimethylpentanedioate |
| SMILES | CCC(C)(CC(C)(C)C(=O)OCCC[Si](CO)(OC)OC)C(=O)OCCO |
| InChI | InChI=1S/C18H36O8Si/c1-7-18(4,16(22)26-11-9-19)13-17(2,3)15(21)25-10-8-12-27(14-20,23-5)24-6/h19-20H,7-14H2,1-6H3 |
| InChIKey | OMQZXZAINWCQJD-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 408.56 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1-O-(2-hydroxyethyl) 5-O-[3-[hydroxymethyl(dimethoxy)silyl]propyl] 2-ethyl-2,4,4-trimethylpentanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-(2-hydroxyethyl) 5-O-[3-[hydroxymethyl(dimethoxy)silyl]propyl] 2-ethyl-2,4,4-trimethylpentanedioate?
The IUPAC name of 1-O-(2-hydroxyethyl) 5-O-[3-[hydroxymethyl(dimethoxy)silyl]propyl] 2-ethyl-2,4,4-trimethylpentanedioate (CID 58338810) is 1-O-(2-hydroxyethyl) 5-O-[3-[hydroxymethyl(dimethoxy)silyl]propyl] 2-ethyl-2,4,4-trimethylpentanedioate.
What is the SMILES notation for 1-O-(2-hydroxyethyl) 5-O-[3-[hydroxymethyl(dimethoxy)silyl]propyl] 2-ethyl-2,4,4-trimethylpentanedioate?
The canonical SMILES for 1-O-(2-hydroxyethyl) 5-O-[3-[hydroxymethyl(dimethoxy)silyl]propyl] 2-ethyl-2,4,4-trimethylpentanedioate is CCC(C)(CC(C)(C)C(=O)OCCC[Si](CO)(OC)OC)C(=O)OCCO.
What is the InChIKey of 1-O-(2-hydroxyethyl) 5-O-[3-[hydroxymethyl(dimethoxy)silyl]propyl] 2-ethyl-2,4,4-trimethylpentanedioate?
The InChIKey is OMQZXZAINWCQJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H36O8Si/c1-7-18(4,16(22)26-11-9-19)13-17(2,3)15(21)25-10-8-12-27(14-20,23-5)24-6/h19-20H,7-14H2,1-6H3.
What are the key properties of 1-O-(2-hydroxyethyl) 5-O-[3-[hydroxymethyl(dimethoxy)silyl]propyl] 2-ethyl-2,4,4-trimethylpentanedioate?
1-O-(2-hydroxyethyl) 5-O-[3-[hydroxymethyl(dimethoxy)silyl]propyl] 2-ethyl-2,4,4-trimethylpentanedioate has a molecular weight of 408.56 g/mol, XLogP of 1.55, 14 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-(2-hydroxyethyl) 5-O-[3-[hydroxymethyl(dimethoxy)silyl]propyl] 2-ethyl-2,4,4-trimethylpentanedioate is sourced from PubChem (CID 58338810), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).