About 4,4-dimethyl-2,6-diphenyl-3H-pyridine
4,4-dimethyl-2,6-diphenyl-3H-pyridine (PubChem CID 58339609) has the molecular formula C19H19N
and a molecular weight of 261.37 g/mol. Its IUPAC name is 4,4-dimethyl-2,6-diphenyl-3H-pyridine.
Molecular Properties
| Compound Name | 4,4-dimethyl-2,6-diphenyl-3H-pyridine |
| PubChem CID | 58339609 |
| Molecular Formula | C19H19N |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | 4,4-dimethyl-2,6-diphenyl-3H-pyridine |
| SMILES | CC1(C)C=C(c2ccccc2)N=C(c2ccccc2)C1 |
| InChI | InChI=1S/C19H19N/c1-19(2)13-17(15-9-5-3-6-10-15)20-18(14-19)16-11-7-4-8-12-16/h3-13H,14H2,1-2H3 |
| InChIKey | JPTHFADCDZLCOH-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4,4-dimethyl-2,6-diphenyl-3H-pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4-dimethyl-2,6-diphenyl-3H-pyridine?
The IUPAC name of 4,4-dimethyl-2,6-diphenyl-3H-pyridine (CID 58339609) is 4,4-dimethyl-2,6-diphenyl-3H-pyridine.
What is the SMILES notation for 4,4-dimethyl-2,6-diphenyl-3H-pyridine?
The canonical SMILES for 4,4-dimethyl-2,6-diphenyl-3H-pyridine is CC1(C)C=C(c2ccccc2)N=C(c2ccccc2)C1.
What is the InChIKey of 4,4-dimethyl-2,6-diphenyl-3H-pyridine?
The InChIKey is JPTHFADCDZLCOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19N/c1-19(2)13-17(15-9-5-3-6-10-15)20-18(14-19)16-11-7-4-8-12-16/h3-13H,14H2,1-2H3.
What are the key properties of 4,4-dimethyl-2,6-diphenyl-3H-pyridine?
4,4-dimethyl-2,6-diphenyl-3H-pyridine has a molecular weight of 261.37 g/mol, XLogP of 4.95, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-dimethyl-2,6-diphenyl-3H-pyridine is sourced from PubChem (CID 58339609), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).