C12H13Cl2NO3S — CID 58339747
(4R,5R)-2-(dichloromethyl)-4-methyl-5-[4-(sulfanylperoxymethyl)phenyl]-4,5-dihydro-1,3-oxazole (PubChem CID 58339747) has the molecular formula C12H13Cl2NO3S and a molecular weight of 322.21 g/mol. Its IUPAC name is (4R,5R)-2-(dichloromethyl)-4-methyl-5-[4-(sulfanylperoxymethyl)phenyl]-4,5-dihydro-1,3-oxazole.
| Compound Name | (4R,5R)-2-(dichloromethyl)-4-methyl-5-[4-(sulfanylperoxymethyl)phenyl]-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 58339747 |
| Molecular Formula | C12H13Cl2NO3S |
| Molecular Weight | 322.21 g/mol |
| Exact Mass | 321.00 |
| IUPAC Name | (4R,5R)-2-(dichloromethyl)-4-methyl-5-[4-(sulfanylperoxymethyl)phenyl]-4,5-dihydro-1,3-oxazole |
| SMILES | C[C@H]1N=C(C(Cl)Cl)O[C@@H]1c1ccc(COOS)cc1 |
| InChI | InChI=1S/C12H13Cl2NO3S/c1-7-10(17-12(15-7)11(13)14)9-4-2-8(3-5-9)6-16-18-19/h2-5,7,10-11,19H,6H2,1H3/t7-,10+/m1/s1 |
| InChIKey | KEJAYZYUUJPJDV-XCBNKYQSSA-N |
| XLogP | 3.64 |
| TPSA | 40.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.21 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|