C20H8Br2I2S6 — CID 58339830
5,12-dibromo-4,11-bis(3-iodo-5-methylthiophen-2-yl)-3,7,10,14-tetrathiatetracyclo[6.6.0.02,6.09,13]tetradeca-1(8),2(6),4,9(13),11-pentaene (PubChem CID 58339830) has the molecular formula C20H8Br2I2S6 and a molecular weight of 854.30 g/mol. Its IUPAC name is 5,12-dibromo-4,11-bis(3-iodo-5-methylthiophen-2-yl)-3,7,10,14-tetrathiatetracyclo[6.6.0.02,6.09,13]tetradeca-1(8),2(6),4,9(13),11-pentaene.
| Compound Name | 5,12-dibromo-4,11-bis(3-iodo-5-methylthiophen-2-yl)-3,7,10,14-tetrathiatetracyclo[6.6.0.02,6.09,13]tetradeca-1(8),2(6),4,9(13),11-pentaene |
|---|---|
| PubChem CID | 58339830 |
| Molecular Formula | C20H8Br2I2S6 |
| Molecular Weight | 854.30 g/mol |
| Exact Mass | 851.54 |
| IUPAC Name | 5,12-dibromo-4,11-bis(3-iodo-5-methylthiophen-2-yl)-3,7,10,14-tetrathiatetracyclo[6.6.0.02,6.09,13]tetradeca-1(8),2(6),4,9(13),11-pentaene |
| SMILES | Cc1cc(I)c(-c2sc3c(sc4c5sc(-c6sc(C)cc6I)c(Br)c5sc34)c2Br)s1 |
| InChI | InChI=1S/C20H8Br2I2S6/c1-5-3-7(23)11(25-5)13-9(21)15-17(27-13)19-20(29-15)18-16(30-19)10(22)14(28-18)12-8(24)4-6(2)26-12/h3-4H,1-2H3 |
| InChIKey | VVSURADYESKBBA-UHFFFAOYSA-N |
| XLogP | 12.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 854.30 |
| LogP ≤ 5 | 12.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|