C32H14Br4S4 — CID 58339933
7,16-dibromo-6,15-bis(2-bromo-4-prop-1-ynylphenyl)-5,9,14,18-tetrathiapentacyclo[10.6.0.03,10.04,8.013,17]octadeca-1(12),2,4(8),6,10,13(17),15-heptaene (PubChem CID 58339933) has the molecular formula C32H14Br4S4 and a molecular weight of 846.35 g/mol. Its IUPAC name is 7,16-dibromo-6,15-bis(2-bromo-4-prop-1-ynylphenyl)-5,9,14,18-tetrathiapentacyclo[10.6.0.03,10.04,8.013,17]octadeca-1(12),2,4(8),6,10,13(17),15-heptaene.
| Compound Name | 7,16-dibromo-6,15-bis(2-bromo-4-prop-1-ynylphenyl)-5,9,14,18-tetrathiapentacyclo[10.6.0.03,10.04,8.013,17]octadeca-1(12),2,4(8),6,10,13(17),15-heptaene |
|---|---|
| PubChem CID | 58339933 |
| Molecular Formula | C32H14Br4S4 |
| Molecular Weight | 846.35 g/mol |
| Exact Mass | 841.67 |
| IUPAC Name | 7,16-dibromo-6,15-bis(2-bromo-4-prop-1-ynylphenyl)-5,9,14,18-tetrathiapentacyclo[10.6.0.03,10.04,8.013,17]octadeca-1(12),2,4(8),6,10,13(17),15-heptaene |
| SMILES | CC#Cc1ccc(-c2sc3c(sc4cc5c(cc43)sc3c(Br)c(-c4ccc(C#CC)cc4Br)sc35)c2Br)c(Br)c1 |
| InChI | InChI=1S/C32H14Br4S4/c1-3-5-15-7-9-17(21(33)11-15)27-25(35)31-29(39-27)19-13-24-20(14-23(19)37-31)30-32(38-24)26(36)28(40-30)18-10-8-16(6-4-2)12-22(18)34/h7-14H,1-2H3 |
| InChIKey | OVWHBTYFZJKYSE-UHFFFAOYSA-N |
| XLogP | 13.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 846.35 |
| LogP ≤ 5 | 13.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|