C16H25N7O7S2 — CID 58340277
3-[[4-[bis(2-hydroxyethyl)amino]-6-[2-(methanesulfonamido)ethylamino]-1,3,5-triazin-2-yl]amino]benzenesulfonic acid (PubChem CID 58340277) has the molecular formula C16H25N7O7S2 and a molecular weight of 491.55 g/mol. Its IUPAC name is 3-[[4-[bis(2-hydroxyethyl)amino]-6-[2-(methanesulfonamido)ethylamino]-1,3,5-triazin-2-yl]amino]benzenesulfonic acid.
| Compound Name | 3-[[4-[bis(2-hydroxyethyl)amino]-6-[2-(methanesulfonamido)ethylamino]-1,3,5-triazin-2-yl]amino]benzenesulfonic acid |
|---|---|
| PubChem CID | 58340277 |
| Molecular Formula | C16H25N7O7S2 |
| Molecular Weight | 491.55 g/mol |
| Exact Mass | 491.13 |
| IUPAC Name | 3-[[4-[bis(2-hydroxyethyl)amino]-6-[2-(methanesulfonamido)ethylamino]-1,3,5-triazin-2-yl]amino]benzenesulfonic acid |
| SMILES | CS(=O)(=O)NCCNc1nc(Nc2cccc(S(=O)(=O)O)c2)nc(N(CCO)CCO)n1 |
| InChI | InChI=1S/C16H25N7O7S2/c1-31(26,27)18-6-5-17-14-20-15(22-16(21-14)23(7-9-24)8-10-25)19-12-3-2-4-13(11-12)32(28,29)30/h2-4,11,18,24-25H,5-10H2,1H3,(H,28,29,30)(H2,17,19,20,21,22) |
| InChIKey | WXERSTOCQFRYEW-UHFFFAOYSA-N |
| XLogP | -1.39 |
| TPSA | 206.97 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.55 |
| LogP ≤ 5 | -1.39 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|