C14H30O4Si2 — CID 58340879
(3R,4S,5R)-6-ethyl-5-methyl-3,4-bis(trimethylsilyloxy)oxan-2-one (PubChem CID 58340879) has the molecular formula C14H30O4Si2 and a molecular weight of 318.56 g/mol. Its IUPAC name is (3R,4S,5R)-6-ethyl-5-methyl-3,4-bis(trimethylsilyloxy)oxan-2-one.
| Compound Name | (3R,4S,5R)-6-ethyl-5-methyl-3,4-bis(trimethylsilyloxy)oxan-2-one |
|---|---|
| PubChem CID | 58340879 |
| Molecular Formula | C14H30O4Si2 |
| Molecular Weight | 318.56 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | (3R,4S,5R)-6-ethyl-5-methyl-3,4-bis(trimethylsilyloxy)oxan-2-one |
| SMILES | CCC1OC(=O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1C |
| InChI | InChI=1S/C14H30O4Si2/c1-9-11-10(2)12(17-19(3,4)5)13(14(15)16-11)18-20(6,7)8/h10-13H,9H2,1-8H3/t10-,11?,12+,13-/m1/s1 |
| InChIKey | SLYPBYASNVIUAH-IBSWDFHHSA-N |
| XLogP | 3.40 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.56 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|