About [2-(4-amino-4-oxobutoxy)-3-(ethylcarbamoyloxy)propyl] N-ethylcarbamate
[2-(4-amino-4-oxobutoxy)-3-(ethylcarbamoyloxy)propyl] N-ethylcarbamate (PubChem CID 58340912) has the molecular formula C13H25N3O6
and a molecular weight of 319.36 g/mol. Its IUPAC name is [2-(4-amino-4-oxobutoxy)-3-(ethylcarbamoyloxy)propyl] N-ethylcarbamate.
Molecular Properties
| Compound Name | [2-(4-amino-4-oxobutoxy)-3-(ethylcarbamoyloxy)propyl] N-ethylcarbamate |
| PubChem CID | 58340912 |
| Molecular Formula | C13H25N3O6 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.17 |
| IUPAC Name | [2-(4-amino-4-oxobutoxy)-3-(ethylcarbamoyloxy)propyl] N-ethylcarbamate |
| SMILES | CCNC(=O)OCC(COC(=O)NCC)OCCCC(N)=O |
| InChI | InChI=1S/C13H25N3O6/c1-3-15-12(18)21-8-10(9-22-13(19)16-4-2)20-7-5-6-11(14)17/h10H,3-9H2,1-2H3,(H2,14,17)(H,15,18)(H,16,19) |
| InChIKey | XGUZFHBEBYBAON-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 128.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [2-(4-amino-4-oxobutoxy)-3-(ethylcarbamoyloxy)propyl] N-ethylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(4-amino-4-oxobutoxy)-3-(ethylcarbamoyloxy)propyl] N-ethylcarbamate?
The IUPAC name of [2-(4-amino-4-oxobutoxy)-3-(ethylcarbamoyloxy)propyl] N-ethylcarbamate (CID 58340912) is [2-(4-amino-4-oxobutoxy)-3-(ethylcarbamoyloxy)propyl] N-ethylcarbamate.
What is the SMILES notation for [2-(4-amino-4-oxobutoxy)-3-(ethylcarbamoyloxy)propyl] N-ethylcarbamate?
The canonical SMILES for [2-(4-amino-4-oxobutoxy)-3-(ethylcarbamoyloxy)propyl] N-ethylcarbamate is CCNC(=O)OCC(COC(=O)NCC)OCCCC(N)=O.
What is the InChIKey of [2-(4-amino-4-oxobutoxy)-3-(ethylcarbamoyloxy)propyl] N-ethylcarbamate?
The InChIKey is XGUZFHBEBYBAON-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25N3O6/c1-3-15-12(18)21-8-10(9-22-13(19)16-4-2)20-7-5-6-11(14)17/h10H,3-9H2,1-2H3,(H2,14,17)(H,15,18)(H,16,19).
What are the key properties of [2-(4-amino-4-oxobutoxy)-3-(ethylcarbamoyloxy)propyl] N-ethylcarbamate?
[2-(4-amino-4-oxobutoxy)-3-(ethylcarbamoyloxy)propyl] N-ethylcarbamate has a molecular weight of 319.36 g/mol, XLogP of 0.13, 11 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(4-amino-4-oxobutoxy)-3-(ethylcarbamoyloxy)propyl] N-ethylcarbamate is sourced from PubChem (CID 58340912), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).