C33H48N8O11 — CID 58340917
ethyl N-[6-[[1,5-bis[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethylamino]-1,5-dioxopentan-3-yl]amino]-5-methyl-6-oxohexyl]carbamate (PubChem CID 58340917) has the molecular formula C33H48N8O11 and a molecular weight of 732.79 g/mol. Its IUPAC name is ethyl N-[6-[[1,5-bis[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethylamino]-1,5-dioxopentan-3-yl]amino]-5-methyl-6-oxohexyl]carbamate.
| Compound Name | ethyl N-[6-[[1,5-bis[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethylamino]-1,5-dioxopentan-3-yl]amino]-5-methyl-6-oxohexyl]carbamate |
|---|---|
| PubChem CID | 58340917 |
| Molecular Formula | C33H48N8O11 |
| Molecular Weight | 732.79 g/mol |
| Exact Mass | 732.34 |
| IUPAC Name | ethyl N-[6-[[1,5-bis[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethylamino]-1,5-dioxopentan-3-yl]amino]-5-methyl-6-oxohexyl]carbamate |
| SMILES | CCOC(=O)NCCCCC(C)C(=O)NC(CC(=O)NCCNC(=O)CCN1C(=O)C=CC1=O)CC(=O)NCCNC(=O)CCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C33H48N8O11/c1-3-52-33(51)38-13-5-4-6-22(2)32(50)39-23(20-26(44)36-16-14-34-24(42)11-18-40-28(46)7-8-29(40)47)21-27(45)37-17-15-35-25(43)12-19-41-30(48)9-10-31(41)49/h7-10,22-23H,3-6,11-21H2,1-2H3,(H,34,42)(H,35,43)(H,36,44)(H,37,45)(H,38,51)(H,39,50) |
| InChIKey | ZHLPMYOKOXWTJK-UHFFFAOYSA-N |
| XLogP | -2.10 |
| TPSA | 258.59 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.79 |
| LogP ≤ 5 | -2.10 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|