C19H29N5O7 — CID 58340919
N'-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethyl]-3-(3-ethoxypropanoylamino)pentanediamide (PubChem CID 58340919) has the molecular formula C19H29N5O7 and a molecular weight of 439.47 g/mol. Its IUPAC name is N'-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethyl]-3-(3-ethoxypropanoylamino)pentanediamide.
| Compound Name | N'-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethyl]-3-(3-ethoxypropanoylamino)pentanediamide |
|---|---|
| PubChem CID | 58340919 |
| Molecular Formula | C19H29N5O7 |
| Molecular Weight | 439.47 g/mol |
| Exact Mass | 439.21 |
| IUPAC Name | N'-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethyl]-3-(3-ethoxypropanoylamino)pentanediamide |
| SMILES | CCOCCC(=O)NC(CC(N)=O)CC(=O)NCCNC(=O)CCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C19H29N5O7/c1-2-31-10-6-16(27)23-13(11-14(20)25)12-17(28)22-8-7-21-15(26)5-9-24-18(29)3-4-19(24)30/h3-4,13H,2,5-12H2,1H3,(H2,20,25)(H,21,26)(H,22,28)(H,23,27) |
| InChIKey | FJHMZWUUVZQJFR-UHFFFAOYSA-N |
| XLogP | -2.29 |
| TPSA | 177.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.47 |
| LogP ≤ 5 | -2.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|