C24H33N7O8 — CID 58340933
N,N'-bis[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethyl]-3-(methylamino)pentanediamide (PubChem CID 58340933) has the molecular formula C24H33N7O8 and a molecular weight of 547.57 g/mol. Its IUPAC name is N,N'-bis[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethyl]-3-(methylamino)pentanediamide.
| Compound Name | N,N'-bis[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethyl]-3-(methylamino)pentanediamide |
|---|---|
| PubChem CID | 58340933 |
| Molecular Formula | C24H33N7O8 |
| Molecular Weight | 547.57 g/mol |
| Exact Mass | 547.24 |
| IUPAC Name | N,N'-bis[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethyl]-3-(methylamino)pentanediamide |
| SMILES | CNC(CC(=O)NCCNC(=O)CCN1C(=O)C=CC1=O)CC(=O)NCCNC(=O)CCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C24H33N7O8/c1-25-16(14-19(34)28-10-8-26-17(32)6-12-30-21(36)2-3-22(30)37)15-20(35)29-11-9-27-18(33)7-13-31-23(38)4-5-24(31)39/h2-5,16,25H,6-15H2,1H3,(H,26,32)(H,27,33)(H,28,34)(H,29,35) |
| InChIKey | WEXHJHJLBYPSLH-UHFFFAOYSA-N |
| XLogP | -3.55 |
| TPSA | 203.19 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.57 |
| LogP ≤ 5 | -3.55 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|