About 2-methoxyethyl N-[2-[2-[4-(2,5-dioxopyrrol-1-yl)butanoylamino]oxyethoxy]ethyl]carbamate
2-methoxyethyl N-[2-[2-[4-(2,5-dioxopyrrol-1-yl)butanoylamino]oxyethoxy]ethyl]carbamate (PubChem CID 58340972) has the molecular formula C16H25N3O8
and a molecular weight of 387.39 g/mol. Its IUPAC name is 2-methoxyethyl N-[2-[2-[4-(2,5-dioxopyrrol-1-yl)butanoylamino]oxyethoxy]ethyl]carbamate.
Molecular Properties
| Compound Name | 2-methoxyethyl N-[2-[2-[4-(2,5-dioxopyrrol-1-yl)butanoylamino]oxyethoxy]ethyl]carbamate |
| PubChem CID | 58340972 |
| Molecular Formula | C16H25N3O8 |
| Molecular Weight | 387.39 g/mol |
| Exact Mass | 387.16 |
| IUPAC Name | 2-methoxyethyl N-[2-[2-[4-(2,5-dioxopyrrol-1-yl)butanoylamino]oxyethoxy]ethyl]carbamate |
| SMILES | COCCOC(=O)NCCOCCONC(=O)CCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C16H25N3O8/c1-24-9-11-26-16(23)17-6-8-25-10-12-27-18-13(20)3-2-7-19-14(21)4-5-15(19)22/h4-5H,2-3,6-12H2,1H3,(H,17,23)(H,18,20) |
| InChIKey | NIKRJKZGIKFIKR-UHFFFAOYSA-N |
| XLogP | -0.87 |
| TPSA | 132.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 387.39 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 2-methoxyethyl N-[2-[2-[4-(2,5-dioxopyrrol-1-yl)butanoylamino]oxyethoxy]ethyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxyethyl N-[2-[2-[4-(2,5-dioxopyrrol-1-yl)butanoylamino]oxyethoxy]ethyl]carbamate?
The IUPAC name of 2-methoxyethyl N-[2-[2-[4-(2,5-dioxopyrrol-1-yl)butanoylamino]oxyethoxy]ethyl]carbamate (CID 58340972) is 2-methoxyethyl N-[2-[2-[4-(2,5-dioxopyrrol-1-yl)butanoylamino]oxyethoxy]ethyl]carbamate.
What is the SMILES notation for 2-methoxyethyl N-[2-[2-[4-(2,5-dioxopyrrol-1-yl)butanoylamino]oxyethoxy]ethyl]carbamate?
The canonical SMILES for 2-methoxyethyl N-[2-[2-[4-(2,5-dioxopyrrol-1-yl)butanoylamino]oxyethoxy]ethyl]carbamate is COCCOC(=O)NCCOCCONC(=O)CCCN1C(=O)C=CC1=O.
What is the InChIKey of 2-methoxyethyl N-[2-[2-[4-(2,5-dioxopyrrol-1-yl)butanoylamino]oxyethoxy]ethyl]carbamate?
The InChIKey is NIKRJKZGIKFIKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H25N3O8/c1-24-9-11-26-16(23)17-6-8-25-10-12-27-18-13(20)3-2-7-19-14(21)4-5-15(19)22/h4-5H,2-3,6-12H2,1H3,(H,17,23)(H,18,20).
What are the key properties of 2-methoxyethyl N-[2-[2-[4-(2,5-dioxopyrrol-1-yl)butanoylamino]oxyethoxy]ethyl]carbamate?
2-methoxyethyl N-[2-[2-[4-(2,5-dioxopyrrol-1-yl)butanoylamino]oxyethoxy]ethyl]carbamate has a molecular weight of 387.39 g/mol, XLogP of -0.87, 14 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxyethyl N-[2-[2-[4-(2,5-dioxopyrrol-1-yl)butanoylamino]oxyethoxy]ethyl]carbamate is sourced from PubChem (CID 58340972), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).