C20H37N5O3 — CID 58341514
2-N-(butoxymethyl)-2-N,4-N-bis(methoxymethyl)-4-N-methyl-6-(4-methylcyclohexyl)-1,3,5-triazine-2,4-diamine (PubChem CID 58341514) has the molecular formula C20H37N5O3 and a molecular weight of 395.55 g/mol. Its IUPAC name is 2-N-(butoxymethyl)-2-N,4-N-bis(methoxymethyl)-4-N-methyl-6-(4-methylcyclohexyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-(butoxymethyl)-2-N,4-N-bis(methoxymethyl)-4-N-methyl-6-(4-methylcyclohexyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 58341514 |
| Molecular Formula | C20H37N5O3 |
| Molecular Weight | 395.55 g/mol |
| Exact Mass | 395.29 |
| IUPAC Name | 2-N-(butoxymethyl)-2-N,4-N-bis(methoxymethyl)-4-N-methyl-6-(4-methylcyclohexyl)-1,3,5-triazine-2,4-diamine |
| SMILES | CCCCOCN(COC)c1nc(C2CCC(C)CC2)nc(N(C)COC)n1 |
| InChI | InChI=1S/C20H37N5O3/c1-6-7-12-28-15-25(14-27-5)20-22-18(17-10-8-16(2)9-11-17)21-19(23-20)24(3)13-26-4/h16-17H,6-15H2,1-5H3 |
| InChIKey | NDCJLYLEQWZSPH-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 72.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.55 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|