C15H27N5O3 — CID 58341525
6-cyclopentyl-2-N,2-N,4-N-tris(methoxymethyl)-4-N-methyl-1,3,5-triazine-2,4-diamine (PubChem CID 58341525) has the molecular formula C15H27N5O3 and a molecular weight of 325.41 g/mol. Its IUPAC name is 6-cyclopentyl-2-N,2-N,4-N-tris(methoxymethyl)-4-N-methyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-cyclopentyl-2-N,2-N,4-N-tris(methoxymethyl)-4-N-methyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 58341525 |
| Molecular Formula | C15H27N5O3 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.21 |
| IUPAC Name | 6-cyclopentyl-2-N,2-N,4-N-tris(methoxymethyl)-4-N-methyl-1,3,5-triazine-2,4-diamine |
| SMILES | COCN(C)c1nc(C2CCCC2)nc(N(COC)COC)n1 |
| InChI | InChI=1S/C15H27N5O3/c1-19(9-21-2)14-16-13(12-7-5-6-8-12)17-15(18-14)20(10-22-3)11-23-4/h12H,5-11H2,1-4H3 |
| InChIKey | HTFCNHQPAUWYNQ-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 72.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|