C17H31N5O3 — CID 58341529
2-N,2-N,4-N-tris(methoxymethyl)-4-N-methyl-6-(4-methylcyclohexyl)-1,3,5-triazine-2,4-diamine (PubChem CID 58341529) has the molecular formula C17H31N5O3 and a molecular weight of 353.47 g/mol. Its IUPAC name is 2-N,2-N,4-N-tris(methoxymethyl)-4-N-methyl-6-(4-methylcyclohexyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N,2-N,4-N-tris(methoxymethyl)-4-N-methyl-6-(4-methylcyclohexyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 58341529 |
| Molecular Formula | C17H31N5O3 |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.24 |
| IUPAC Name | 2-N,2-N,4-N-tris(methoxymethyl)-4-N-methyl-6-(4-methylcyclohexyl)-1,3,5-triazine-2,4-diamine |
| SMILES | COCN(C)c1nc(C2CCC(C)CC2)nc(N(COC)COC)n1 |
| InChI | InChI=1S/C17H31N5O3/c1-13-6-8-14(9-7-13)15-18-16(21(2)10-23-3)20-17(19-15)22(11-24-4)12-25-5/h13-14H,6-12H2,1-5H3 |
| InChIKey | ABQKMPMSRNQYEX-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 72.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|