About 2,2-dimethylpropyl 2-piperidin-1-ylacetate
2,2-dimethylpropyl 2-piperidin-1-ylacetate (PubChem CID 58341565) has the molecular formula C12H23NO2
and a molecular weight of 213.32 g/mol. Its IUPAC name is 2,2-dimethylpropyl 2-piperidin-1-ylacetate.
Molecular Properties
| Compound Name | 2,2-dimethylpropyl 2-piperidin-1-ylacetate |
| PubChem CID | 58341565 |
| Molecular Formula | C12H23NO2 |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.17 |
| IUPAC Name | 2,2-dimethylpropyl 2-piperidin-1-ylacetate |
| SMILES | CC(C)(C)COC(=O)CN1CCCCC1 |
| InChI | InChI=1S/C12H23NO2/c1-12(2,3)10-15-11(14)9-13-7-5-4-6-8-13/h4-10H2,1-3H3 |
| InChIKey | GODWSURDWCJBRH-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,2-dimethylpropyl 2-piperidin-1-ylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethylpropyl 2-piperidin-1-ylacetate?
The IUPAC name of 2,2-dimethylpropyl 2-piperidin-1-ylacetate (CID 58341565) is 2,2-dimethylpropyl 2-piperidin-1-ylacetate.
What is the SMILES notation for 2,2-dimethylpropyl 2-piperidin-1-ylacetate?
The canonical SMILES for 2,2-dimethylpropyl 2-piperidin-1-ylacetate is CC(C)(C)COC(=O)CN1CCCCC1.
What is the InChIKey of 2,2-dimethylpropyl 2-piperidin-1-ylacetate?
The InChIKey is GODWSURDWCJBRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23NO2/c1-12(2,3)10-15-11(14)9-13-7-5-4-6-8-13/h4-10H2,1-3H3.
What are the key properties of 2,2-dimethylpropyl 2-piperidin-1-ylacetate?
2,2-dimethylpropyl 2-piperidin-1-ylacetate has a molecular weight of 213.32 g/mol, XLogP of 2.06, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethylpropyl 2-piperidin-1-ylacetate is sourced from PubChem (CID 58341565), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).