About 6-morpholin-4-ylhexyl 2,2-difluoropropanoate
6-morpholin-4-ylhexyl 2,2-difluoropropanoate (PubChem CID 58341585) has the molecular formula C13H23F2NO3
and a molecular weight of 279.33 g/mol. Its IUPAC name is 6-morpholin-4-ylhexyl 2,2-difluoropropanoate.
Molecular Properties
| Compound Name | 6-morpholin-4-ylhexyl 2,2-difluoropropanoate |
| PubChem CID | 58341585 |
| Molecular Formula | C13H23F2NO3 |
| Molecular Weight | 279.33 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | 6-morpholin-4-ylhexyl 2,2-difluoropropanoate |
| SMILES | CC(F)(F)C(=O)OCCCCCCN1CCOCC1 |
| InChI | InChI=1S/C13H23F2NO3/c1-13(14,15)12(17)19-9-5-3-2-4-6-16-7-10-18-11-8-16/h2-11H2,1H3 |
| InChIKey | HWELSQMLIITWJX-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.33 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-morpholin-4-ylhexyl 2,2-difluoropropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-morpholin-4-ylhexyl 2,2-difluoropropanoate?
The IUPAC name of 6-morpholin-4-ylhexyl 2,2-difluoropropanoate (CID 58341585) is 6-morpholin-4-ylhexyl 2,2-difluoropropanoate.
What is the SMILES notation for 6-morpholin-4-ylhexyl 2,2-difluoropropanoate?
The canonical SMILES for 6-morpholin-4-ylhexyl 2,2-difluoropropanoate is CC(F)(F)C(=O)OCCCCCCN1CCOCC1.
What is the InChIKey of 6-morpholin-4-ylhexyl 2,2-difluoropropanoate?
The InChIKey is HWELSQMLIITWJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23F2NO3/c1-13(14,15)12(17)19-9-5-3-2-4-6-16-7-10-18-11-8-16/h2-11H2,1H3.
What are the key properties of 6-morpholin-4-ylhexyl 2,2-difluoropropanoate?
6-morpholin-4-ylhexyl 2,2-difluoropropanoate has a molecular weight of 279.33 g/mol, XLogP of 2.08, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-morpholin-4-ylhexyl 2,2-difluoropropanoate is sourced from PubChem (CID 58341585), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).