About (2-oxo-3H-1,3-benzoxazol-6-yl) 2,2-dimethylbutanoate
(2-oxo-3H-1,3-benzoxazol-6-yl) 2,2-dimethylbutanoate (PubChem CID 58341838) has the molecular formula C13H15NO4
and a molecular weight of 249.27 g/mol. Its IUPAC name is (2-oxo-3H-1,3-benzoxazol-6-yl) 2,2-dimethylbutanoate.
Molecular Properties
| Compound Name | (2-oxo-3H-1,3-benzoxazol-6-yl) 2,2-dimethylbutanoate |
| PubChem CID | 58341838 |
| Molecular Formula | C13H15NO4 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | (2-oxo-3H-1,3-benzoxazol-6-yl) 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)Oc1ccc2[nH]c(=O)oc2c1 |
| InChI | InChI=1S/C13H15NO4/c1-4-13(2,3)11(15)17-8-5-6-9-10(7-8)18-12(16)14-9/h5-7H,4H2,1-3H3,(H,14,16) |
| InChIKey | VDIPTYHFVRKHKS-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 72.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (2-oxo-3H-1,3-benzoxazol-6-yl) 2,2-dimethylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-oxo-3H-1,3-benzoxazol-6-yl) 2,2-dimethylbutanoate?
The IUPAC name of (2-oxo-3H-1,3-benzoxazol-6-yl) 2,2-dimethylbutanoate (CID 58341838) is (2-oxo-3H-1,3-benzoxazol-6-yl) 2,2-dimethylbutanoate.
What is the SMILES notation for (2-oxo-3H-1,3-benzoxazol-6-yl) 2,2-dimethylbutanoate?
The canonical SMILES for (2-oxo-3H-1,3-benzoxazol-6-yl) 2,2-dimethylbutanoate is CCC(C)(C)C(=O)Oc1ccc2[nH]c(=O)oc2c1.
What is the InChIKey of (2-oxo-3H-1,3-benzoxazol-6-yl) 2,2-dimethylbutanoate?
The InChIKey is VDIPTYHFVRKHKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15NO4/c1-4-13(2,3)11(15)17-8-5-6-9-10(7-8)18-12(16)14-9/h5-7H,4H2,1-3H3,(H,14,16).
What are the key properties of (2-oxo-3H-1,3-benzoxazol-6-yl) 2,2-dimethylbutanoate?
(2-oxo-3H-1,3-benzoxazol-6-yl) 2,2-dimethylbutanoate has a molecular weight of 249.27 g/mol, XLogP of 2.46, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-oxo-3H-1,3-benzoxazol-6-yl) 2,2-dimethylbutanoate is sourced from PubChem (CID 58341838), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).