About (2-oxo-3H-1,3-benzoxazol-6-yl) 2-methylprop-2-enoate
(2-oxo-3H-1,3-benzoxazol-6-yl) 2-methylprop-2-enoate (PubChem CID 58341844) has the molecular formula C11H9NO4
and a molecular weight of 219.20 g/mol. Its IUPAC name is (2-oxo-3H-1,3-benzoxazol-6-yl) 2-methylprop-2-enoate.
Molecular Properties
| Compound Name | (2-oxo-3H-1,3-benzoxazol-6-yl) 2-methylprop-2-enoate |
| PubChem CID | 58341844 |
| Molecular Formula | C11H9NO4 |
| Molecular Weight | 219.20 g/mol |
| Exact Mass | 219.05 |
| IUPAC Name | (2-oxo-3H-1,3-benzoxazol-6-yl) 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1ccc2[nH]c(=O)oc2c1 |
| InChI | InChI=1S/C11H9NO4/c1-6(2)10(13)15-7-3-4-8-9(5-7)16-11(14)12-8/h3-5H,1H2,2H3,(H,12,14) |
| InChIKey | SVGLNVZTLSQYMN-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 72.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.20 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (2-oxo-3H-1,3-benzoxazol-6-yl) 2-methylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-oxo-3H-1,3-benzoxazol-6-yl) 2-methylprop-2-enoate?
The IUPAC name of (2-oxo-3H-1,3-benzoxazol-6-yl) 2-methylprop-2-enoate (CID 58341844) is (2-oxo-3H-1,3-benzoxazol-6-yl) 2-methylprop-2-enoate.
What is the SMILES notation for (2-oxo-3H-1,3-benzoxazol-6-yl) 2-methylprop-2-enoate?
The canonical SMILES for (2-oxo-3H-1,3-benzoxazol-6-yl) 2-methylprop-2-enoate is C=C(C)C(=O)Oc1ccc2[nH]c(=O)oc2c1.
What is the InChIKey of (2-oxo-3H-1,3-benzoxazol-6-yl) 2-methylprop-2-enoate?
The InChIKey is SVGLNVZTLSQYMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9NO4/c1-6(2)10(13)15-7-3-4-8-9(5-7)16-11(14)12-8/h3-5H,1H2,2H3,(H,12,14).
What are the key properties of (2-oxo-3H-1,3-benzoxazol-6-yl) 2-methylprop-2-enoate?
(2-oxo-3H-1,3-benzoxazol-6-yl) 2-methylprop-2-enoate has a molecular weight of 219.20 g/mol, XLogP of 1.60, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-oxo-3H-1,3-benzoxazol-6-yl) 2-methylprop-2-enoate is sourced from PubChem (CID 58341844), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).