C16H19N2PS — CID 58342208
[4-(2,3-dimethylimidazo[2,1-b][1,3]thiazol-6-yl)-2,3-dimethylphenyl]methylphosphane (PubChem CID 58342208) has the molecular formula C16H19N2PS and a molecular weight of 302.38 g/mol. Its IUPAC name is [4-(2,3-dimethylimidazo[2,1-b][1,3]thiazol-6-yl)-2,3-dimethylphenyl]methylphosphane.
| Compound Name | [4-(2,3-dimethylimidazo[2,1-b][1,3]thiazol-6-yl)-2,3-dimethylphenyl]methylphosphane |
|---|---|
| PubChem CID | 58342208 |
| Molecular Formula | C16H19N2PS |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.10 |
| IUPAC Name | [4-(2,3-dimethylimidazo[2,1-b][1,3]thiazol-6-yl)-2,3-dimethylphenyl]methylphosphane |
| SMILES | Cc1sc2nc(-c3ccc(CP)c(C)c3C)cn2c1C |
| InChI | InChI=1S/C16H19N2PS/c1-9-10(2)14(6-5-13(9)8-19)15-7-18-11(3)12(4)20-16(18)17-15/h5-7H,8,19H2,1-4H3 |
| InChIKey | NLAMJRRJKPSFQL-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|