About 10,14-diamino-2-methyltetradec-1-ene-3,9-dione
10,14-diamino-2-methyltetradec-1-ene-3,9-dione (PubChem CID 58342261) has the molecular formula C15H28N2O2
and a molecular weight of 268.40 g/mol. Its IUPAC name is 10,14-diamino-2-methyltetradec-1-ene-3,9-dione.
Molecular Properties
| Compound Name | 10,14-diamino-2-methyltetradec-1-ene-3,9-dione |
| PubChem CID | 58342261 |
| Molecular Formula | C15H28N2O2 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.22 |
| IUPAC Name | 10,14-diamino-2-methyltetradec-1-ene-3,9-dione |
| SMILES | C=C(C)C(=O)CCCCCC(=O)C(N)CCCCN |
| InChI | InChI=1S/C15H28N2O2/c1-12(2)14(18)9-4-3-5-10-15(19)13(17)8-6-7-11-16/h13H,1,3-11,16-17H2,2H3 |
| InChIKey | UPAJTDDRAUTMHD-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 10,14-diamino-2-methyltetradec-1-ene-3,9-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10,14-diamino-2-methyltetradec-1-ene-3,9-dione?
The IUPAC name of 10,14-diamino-2-methyltetradec-1-ene-3,9-dione (CID 58342261) is 10,14-diamino-2-methyltetradec-1-ene-3,9-dione.
What is the SMILES notation for 10,14-diamino-2-methyltetradec-1-ene-3,9-dione?
The canonical SMILES for 10,14-diamino-2-methyltetradec-1-ene-3,9-dione is C=C(C)C(=O)CCCCCC(=O)C(N)CCCCN.
What is the InChIKey of 10,14-diamino-2-methyltetradec-1-ene-3,9-dione?
The InChIKey is UPAJTDDRAUTMHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H28N2O2/c1-12(2)14(18)9-4-3-5-10-15(19)13(17)8-6-7-11-16/h13H,1,3-11,16-17H2,2H3.
What are the key properties of 10,14-diamino-2-methyltetradec-1-ene-3,9-dione?
10,14-diamino-2-methyltetradec-1-ene-3,9-dione has a molecular weight of 268.40 g/mol, XLogP of 2.11, 12 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 10,14-diamino-2-methyltetradec-1-ene-3,9-dione is sourced from PubChem (CID 58342261), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).