About 2-methyl-5-(4-methylcyclopenta-1,3-dien-1-yl)-1H-pyrrole
2-methyl-5-(4-methylcyclopenta-1,3-dien-1-yl)-1H-pyrrole (PubChem CID 58342273) has the molecular formula C11H13N
and a molecular weight of 159.23 g/mol. Its IUPAC name is 2-methyl-5-(4-methylcyclopenta-1,3-dien-1-yl)-1H-pyrrole.
Molecular Properties
| Compound Name | 2-methyl-5-(4-methylcyclopenta-1,3-dien-1-yl)-1H-pyrrole |
| PubChem CID | 58342273 |
| Molecular Formula | C11H13N |
| Molecular Weight | 159.23 g/mol |
| Exact Mass | 159.10 |
| IUPAC Name | 2-methyl-5-(4-methylcyclopenta-1,3-dien-1-yl)-1H-pyrrole |
| SMILES | CC1=CC=C(c2ccc(C)[nH]2)C1 |
| InChI | InChI=1S/C11H13N/c1-8-3-5-10(7-8)11-6-4-9(2)12-11/h3-6,12H,7H2,1-2H3 |
| InChIKey | DAPBWNFJEGQLIG-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.23 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2-methyl-5-(4-methylcyclopenta-1,3-dien-1-yl)-1H-pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-5-(4-methylcyclopenta-1,3-dien-1-yl)-1H-pyrrole?
The IUPAC name of 2-methyl-5-(4-methylcyclopenta-1,3-dien-1-yl)-1H-pyrrole (CID 58342273) is 2-methyl-5-(4-methylcyclopenta-1,3-dien-1-yl)-1H-pyrrole.
What is the SMILES notation for 2-methyl-5-(4-methylcyclopenta-1,3-dien-1-yl)-1H-pyrrole?
The canonical SMILES for 2-methyl-5-(4-methylcyclopenta-1,3-dien-1-yl)-1H-pyrrole is CC1=CC=C(c2ccc(C)[nH]2)C1.
What is the InChIKey of 2-methyl-5-(4-methylcyclopenta-1,3-dien-1-yl)-1H-pyrrole?
The InChIKey is DAPBWNFJEGQLIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13N/c1-8-3-5-10(7-8)11-6-4-9(2)12-11/h3-6,12H,7H2,1-2H3.
What are the key properties of 2-methyl-5-(4-methylcyclopenta-1,3-dien-1-yl)-1H-pyrrole?
2-methyl-5-(4-methylcyclopenta-1,3-dien-1-yl)-1H-pyrrole has a molecular weight of 159.23 g/mol, XLogP of 3.06, 1 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-5-(4-methylcyclopenta-1,3-dien-1-yl)-1H-pyrrole is sourced from PubChem (CID 58342273), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).