About 7-methylpyrazolo[1,5-a]pyridine
7-methylpyrazolo[1,5-a]pyridine (PubChem CID 583434) has the molecular formula C8H8N2
and a molecular weight of 132.17 g/mol. Its IUPAC name is 7-methylpyrazolo[1,5-a]pyridine.
Molecular Properties
| Compound Name | 7-methylpyrazolo[1,5-a]pyridine |
| PubChem CID | 583434 |
| Molecular Formula | C8H8N2 |
| Molecular Weight | 132.17 g/mol |
| Exact Mass | 132.07 |
| IUPAC Name | 7-methylpyrazolo[1,5-a]pyridine |
| SMILES | Cc1cccc2ccnn12 |
| InChI | InChI=1S/C8H8N2/c1-7-3-2-4-8-5-6-9-10(7)8/h2-6H,1H3 |
| InChIKey | WWDGTWAATSJUIM-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.17 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-methylpyrazolo[1,5-a]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methylpyrazolo[1,5-a]pyridine?
The IUPAC name of 7-methylpyrazolo[1,5-a]pyridine (CID 583434) is 7-methylpyrazolo[1,5-a]pyridine.
What is the SMILES notation for 7-methylpyrazolo[1,5-a]pyridine?
The canonical SMILES for 7-methylpyrazolo[1,5-a]pyridine is Cc1cccc2ccnn12.
What is the InChIKey of 7-methylpyrazolo[1,5-a]pyridine?
The InChIKey is WWDGTWAATSJUIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2/c1-7-3-2-4-8-5-6-9-10(7)8/h2-6H,1H3.
What are the key properties of 7-methylpyrazolo[1,5-a]pyridine?
7-methylpyrazolo[1,5-a]pyridine has a molecular weight of 132.17 g/mol, XLogP of 1.64, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methylpyrazolo[1,5-a]pyridine is sourced from PubChem (CID 583434), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).