C15H34O4Si3 — CID 58343630
(3R,4S,5S,6R)-5-methyl-6-trimethylsilyl-3,4-bis(trimethylsilyloxy)oxan-2-one (PubChem CID 58343630) has the molecular formula C15H34O4Si3 and a molecular weight of 362.69 g/mol. Its IUPAC name is (3R,4S,5S,6R)-5-methyl-6-trimethylsilyl-3,4-bis(trimethylsilyloxy)oxan-2-one.
| Compound Name | (3R,4S,5S,6R)-5-methyl-6-trimethylsilyl-3,4-bis(trimethylsilyloxy)oxan-2-one |
|---|---|
| PubChem CID | 58343630 |
| Molecular Formula | C15H34O4Si3 |
| Molecular Weight | 362.69 g/mol |
| Exact Mass | 362.18 |
| IUPAC Name | (3R,4S,5S,6R)-5-methyl-6-trimethylsilyl-3,4-bis(trimethylsilyloxy)oxan-2-one |
| SMILES | C[C@H]1[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(=O)O[C@@H]1[Si](C)(C)C |
| InChI | InChI=1S/C15H34O4Si3/c1-11-12(18-21(5,6)7)13(19-22(8,9)10)14(16)17-15(11)20(2,3)4/h11-13,15H,1-10H3/t11-,12-,13+,15+/m0/s1 |
| InChIKey | GTOODQUEIHAGEB-RMRHIDDWSA-N |
| XLogP | 3.87 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.69 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|