About 2-benzyl-1-hydroxythieno[2,3-d]diazaborinine
2-benzyl-1-hydroxythieno[2,3-d]diazaborinine (PubChem CID 58343687) has the molecular formula C12H11BN2OS
and a molecular weight of 242.11 g/mol. Its IUPAC name is 2-benzyl-1-hydroxythieno[2,3-d]diazaborinine.
Molecular Properties
| Compound Name | 2-benzyl-1-hydroxythieno[2,3-d]diazaborinine |
| PubChem CID | 58343687 |
| Molecular Formula | C12H11BN2OS |
| Molecular Weight | 242.11 g/mol |
| Exact Mass | 242.07 |
| IUPAC Name | 2-benzyl-1-hydroxythieno[2,3-d]diazaborinine |
| SMILES | OB1c2sccc2C=NN1Cc1ccccc1 |
| InChI | InChI=1S/C12H11BN2OS/c16-13-12-11(6-7-17-12)8-14-15(13)9-10-4-2-1-3-5-10/h1-8,16H,9H2 |
| InChIKey | HSTIRJHBTZBFIS-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 35.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.11 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-benzyl-1-hydroxythieno[2,3-d]diazaborinine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzyl-1-hydroxythieno[2,3-d]diazaborinine?
The IUPAC name of 2-benzyl-1-hydroxythieno[2,3-d]diazaborinine (CID 58343687) is 2-benzyl-1-hydroxythieno[2,3-d]diazaborinine.
What is the SMILES notation for 2-benzyl-1-hydroxythieno[2,3-d]diazaborinine?
The canonical SMILES for 2-benzyl-1-hydroxythieno[2,3-d]diazaborinine is OB1c2sccc2C=NN1Cc1ccccc1.
What is the InChIKey of 2-benzyl-1-hydroxythieno[2,3-d]diazaborinine?
The InChIKey is HSTIRJHBTZBFIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11BN2OS/c16-13-12-11(6-7-17-12)8-14-15(13)9-10-4-2-1-3-5-10/h1-8,16H,9H2.
What are the key properties of 2-benzyl-1-hydroxythieno[2,3-d]diazaborinine?
2-benzyl-1-hydroxythieno[2,3-d]diazaborinine has a molecular weight of 242.11 g/mol, XLogP of 1.29, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzyl-1-hydroxythieno[2,3-d]diazaborinine is sourced from PubChem (CID 58343687), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).