C23H26BNO6 — CID 58343798
[4-[5-methyl-4-[2-[4-(2-methyl-3-oxobutan-2-yl)oxyphenoxy]ethyl]-1,3-oxazol-2-yl]phenyl]boronic acid (PubChem CID 58343798) has the molecular formula C23H26BNO6 and a molecular weight of 423.27 g/mol. Its IUPAC name is [4-[5-methyl-4-[2-[4-(2-methyl-3-oxobutan-2-yl)oxyphenoxy]ethyl]-1,3-oxazol-2-yl]phenyl]boronic acid.
| Compound Name | [4-[5-methyl-4-[2-[4-(2-methyl-3-oxobutan-2-yl)oxyphenoxy]ethyl]-1,3-oxazol-2-yl]phenyl]boronic acid |
|---|---|
| PubChem CID | 58343798 |
| Molecular Formula | C23H26BNO6 |
| Molecular Weight | 423.27 g/mol |
| Exact Mass | 423.19 |
| IUPAC Name | [4-[5-methyl-4-[2-[4-(2-methyl-3-oxobutan-2-yl)oxyphenoxy]ethyl]-1,3-oxazol-2-yl]phenyl]boronic acid |
| SMILES | CC(=O)C(C)(C)Oc1ccc(OCCc2nc(-c3ccc(B(O)O)cc3)oc2C)cc1 |
| InChI | InChI=1S/C23H26BNO6/c1-15-21(25-22(30-15)17-5-7-18(8-6-17)24(27)28)13-14-29-19-9-11-20(12-10-19)31-23(3,4)16(2)26/h5-12,27-28H,13-14H2,1-4H3 |
| InChIKey | WQHHJNUMHBUBSV-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 102.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.27 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|